C25H24O4S — CID 140915815
5-[(4-ethoxy-5-methylnaphthalen-1-yl)methyl]-4-methylnaphthalene-1-sulfonic acid (PubChem CID 140915815) has the molecular formula C25H24O4S and a molecular weight of 420.53 g/mol. Its IUPAC name is 5-[(4-ethoxy-5-methylnaphthalen-1-yl)methyl]-4-methylnaphthalene-1-sulfonic acid.
| Compound Name | 5-[(4-ethoxy-5-methylnaphthalen-1-yl)methyl]-4-methylnaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 140915815 |
| Molecular Formula | C25H24O4S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 5-[(4-ethoxy-5-methylnaphthalen-1-yl)methyl]-4-methylnaphthalene-1-sulfonic acid |
| SMILES | CCOc1ccc(Cc2cccc3c(S(=O)(=O)O)ccc(C)c23)c2cccc(C)c12 |
| InChI | InChI=1S/C25H24O4S/c1-4-29-22-13-12-18(20-9-5-7-16(2)25(20)22)15-19-8-6-10-21-23(30(26,27)28)14-11-17(3)24(19)21/h5-14H,4,15H2,1-3H3,(H,26,27,28) |
| InChIKey | BNABEKUPESDCRX-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|