5,8-dipropylnaphthalene-1-sulfonic acid

C16H20O3S — CID 101322469

IUPAC5,8-dipropylnaphthalene-1-sulfonic acid
SMILESCCCc1ccc(CCC)c2c(S(=O)(=O)O)cccc12
InChIInChI=1S/C16H20O3S/c1-3-6-12-10-11-13(7-4-2)16-14(12)8-5-9-15(16)20(17,18)19/h5,8-11H,3-4,6-7H2,1-2H3,(H,17,18,19)
InChIKeyFQIYDVALEKOYEH-UHFFFAOYSA-N
MW292.40 g/mol
LogP3.99
Rot. Bonds5

About 5,8-dipropylnaphthalene-1-sulfonic acid

5,8-dipropylnaphthalene-1-sulfonic acid (PubChem CID 101322469) has the molecular formula C16H20O3S and a molecular weight of 292.40 g/mol. Its IUPAC name is 5,8-dipropylnaphthalene-1-sulfonic acid.

Molecular Properties

Compound Name5,8-dipropylnaphthalene-1-sulfonic acid
PubChem CID101322469
Molecular FormulaC16H20O3S
Molecular Weight292.40 g/mol
Exact Mass292.11
IUPAC Name5,8-dipropylnaphthalene-1-sulfonic acid
SMILESCCCc1ccc(CCC)c2c(S(=O)(=O)O)cccc12
InChIInChI=1S/C16H20O3S/c1-3-6-12-10-11-13(7-4-2)16-14(12)8-5-9-15(16)20(17,18)19/h5,8-11H,3-4,6-7H2,1-2H3,(H,17,18,19)
InChIKeyFQIYDVALEKOYEH-UHFFFAOYSA-N
XLogP3.99
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.40
LogP ≤ 53.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 5,8-dipropylnaphthalene-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,8-dipropylnaphthalene-1-sulfonic acid?
The IUPAC name of 5,8-dipropylnaphthalene-1-sulfonic acid (CID 101322469) is 5,8-dipropylnaphthalene-1-sulfonic acid.
What is the SMILES notation for 5,8-dipropylnaphthalene-1-sulfonic acid?
The canonical SMILES for 5,8-dipropylnaphthalene-1-sulfonic acid is CCCc1ccc(CCC)c2c(S(=O)(=O)O)cccc12.
What is the InChIKey of 5,8-dipropylnaphthalene-1-sulfonic acid?
The InChIKey is FQIYDVALEKOYEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O3S/c1-3-6-12-10-11-13(7-4-2)16-14(12)8-5-9-15(16)20(17,18)19/h5,8-11H,3-4,6-7H2,1-2H3,(H,17,18,19).
What are the key properties of 5,8-dipropylnaphthalene-1-sulfonic acid?
5,8-dipropylnaphthalene-1-sulfonic acid has a molecular weight of 292.40 g/mol, XLogP of 3.99, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-dipropylnaphthalene-1-sulfonic acid is sourced from PubChem (CID 101322469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).