5,8-dipentylnaphthalene-1-sulfonic acid

C20H28O3S — CID 101322538

IUPAC5,8-dipentylnaphthalene-1-sulfonic acid
SMILESCCCCCc1ccc(CCCCC)c2c(S(=O)(=O)O)cccc12
InChIInChI=1S/C20H28O3S/c1-3-5-7-10-16-14-15-17(11-8-6-4-2)20-18(16)12-9-13-19(20)24(21,22)23/h9,12-15H,3-8,10-11H2,1-2H3,(H,21,22,23)
InChIKeyVOHXTEHDELUYDF-UHFFFAOYSA-N
MW348.51 g/mol
LogP5.55
Rot. Bonds9

About 5,8-dipentylnaphthalene-1-sulfonic acid

5,8-dipentylnaphthalene-1-sulfonic acid (PubChem CID 101322538) has the molecular formula C20H28O3S and a molecular weight of 348.51 g/mol. Its IUPAC name is 5,8-dipentylnaphthalene-1-sulfonic acid.

Molecular Properties

Compound Name5,8-dipentylnaphthalene-1-sulfonic acid
PubChem CID101322538
Molecular FormulaC20H28O3S
Molecular Weight348.51 g/mol
Exact Mass348.18
IUPAC Name5,8-dipentylnaphthalene-1-sulfonic acid
SMILESCCCCCc1ccc(CCCCC)c2c(S(=O)(=O)O)cccc12
InChIInChI=1S/C20H28O3S/c1-3-5-7-10-16-14-15-17(11-8-6-4-2)20-18(16)12-9-13-19(20)24(21,22)23/h9,12-15H,3-8,10-11H2,1-2H3,(H,21,22,23)
InChIKeyVOHXTEHDELUYDF-UHFFFAOYSA-N
XLogP5.55
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds9
Heavy Atoms24
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500348.51
LogP ≤ 55.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 5,8-dipentylnaphthalene-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4,8-dipentylnaphthalene-1-sulfonic acid
CID 101322532
5,8-dipropylnaphthalene-1-sulfonic acid
CID 101322469
4,5-di(tetradecyl)naphthalene-1-sulfonic acid
CID 101319199
8-methoxy-4-tetradecylnaphthalene-1-sulfonic acid
CID 101310381
calcium bis(5,8-dipentylnaphthalene-1-sulfonate)
CID 101324530
5,8-di(nonyl)naphthalene-1,2-disulfonic acid
CID 57207242
calcium bis(5,8-di(tetradecyl)naphthalene-1-sulfonate)
CID 101324713
4,5-dibutylnaphthalene-1-sulfonic acid
CID 54390432
5,6-di(nonyl)naphthalene-1-sulfonic acid
CID 101309956
6,7-di(tridecyl)naphthalene-1-sulfonic acid
CID 101319172
4-ethyl-1,5-dipentylnaphthalene
CID 90697444
calcium bis(5,8-dibutylnaphthalene-1-sulfonate)
CID 101324509

Frequently Asked Questions

What is the IUPAC name of 5,8-dipentylnaphthalene-1-sulfonic acid?
The IUPAC name of 5,8-dipentylnaphthalene-1-sulfonic acid (CID 101322538) is 5,8-dipentylnaphthalene-1-sulfonic acid.
What is the SMILES notation for 5,8-dipentylnaphthalene-1-sulfonic acid?
The canonical SMILES for 5,8-dipentylnaphthalene-1-sulfonic acid is CCCCCc1ccc(CCCCC)c2c(S(=O)(=O)O)cccc12.
What is the InChIKey of 5,8-dipentylnaphthalene-1-sulfonic acid?
The InChIKey is VOHXTEHDELUYDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28O3S/c1-3-5-7-10-16-14-15-17(11-8-6-4-2)20-18(16)12-9-13-19(20)24(21,22)23/h9,12-15H,3-8,10-11H2,1-2H3,(H,21,22,23).
What are the key properties of 5,8-dipentylnaphthalene-1-sulfonic acid?
5,8-dipentylnaphthalene-1-sulfonic acid has a molecular weight of 348.51 g/mol, XLogP of 5.55, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-dipentylnaphthalene-1-sulfonic acid is sourced from PubChem (CID 101322538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).