C22H32 — CID 90697444
4-ethyl-1,5-dipentylnaphthalene (PubChem CID 90697444) has the molecular formula C22H32 and a molecular weight of 296.50 g/mol. Its IUPAC name is 4-ethyl-1,5-dipentylnaphthalene.
| Compound Name | 4-ethyl-1,5-dipentylnaphthalene |
|---|---|
| PubChem CID | 90697444 |
| Molecular Formula | C22H32 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 4-ethyl-1,5-dipentylnaphthalene |
| SMILES | CCCCCc1ccc(CC)c2c(CCCCC)cccc12 |
| InChI | InChI=1S/C22H32/c1-4-7-9-12-19-17-16-18(6-3)22-20(13-10-8-5-2)14-11-15-21(19)22/h11,14-17H,4-10,12-13H2,1-3H3 |
| InChIKey | CSVDVRHVDFDCNF-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|