C20H18NO5S- — CID 5046040
2-[4-[(4-ethoxynaphthalen-1-yl)sulfonylamino]phenyl]acetate (PubChem CID 5046040) has the molecular formula C20H18NO5S- and a molecular weight of 384.43 g/mol. Its IUPAC name is 2-[4-[(4-ethoxynaphthalen-1-yl)sulfonylamino]phenyl]acetate.
| Compound Name | 2-[4-[(4-ethoxynaphthalen-1-yl)sulfonylamino]phenyl]acetate |
|---|---|
| PubChem CID | 5046040 |
| Molecular Formula | C20H18NO5S- |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 2-[4-[(4-ethoxynaphthalen-1-yl)sulfonylamino]phenyl]acetate |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccc(CC(=O)[O-])cc2)c2ccccc12 |
| InChI | InChI=1S/C20H19NO5S/c1-2-26-18-11-12-19(17-6-4-3-5-16(17)18)27(24,25)21-15-9-7-14(8-10-15)13-20(22)23/h3-12,21H,2,13H2,1H3,(H,22,23)/p-1 |
| InChIKey | UHYZYQSYSRZDHK-UHFFFAOYSA-M |
| XLogP | 2.33 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |