C16H19NO3S — CID 172880543
N-cyclobutyl-4-ethoxynaphthalene-1-sulfonamide (PubChem CID 172880543) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is N-cyclobutyl-4-ethoxynaphthalene-1-sulfonamide.
| Compound Name | N-cyclobutyl-4-ethoxynaphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 172880543 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | N-cyclobutyl-4-ethoxynaphthalene-1-sulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NC2CCC2)c2ccccc12 |
| InChI | InChI=1S/C16H19NO3S/c1-2-20-15-10-11-16(14-9-4-3-8-13(14)15)21(18,19)17-12-6-5-7-12/h3-4,8-12,17H,2,5-7H2,1H3 |
| InChIKey | YTGRGDBNMVNFDT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |