C16H19NO3S — CID 7314514
N-cyclopentyl-4-methoxynaphthalene-1-sulfonamide (PubChem CID 7314514) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is N-cyclopentyl-4-methoxynaphthalene-1-sulfonamide.
| Compound Name | N-cyclopentyl-4-methoxynaphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 7314514 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | N-cyclopentyl-4-methoxynaphthalene-1-sulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC2CCCC2)c2ccccc12 |
| InChI | InChI=1S/C16H19NO3S/c1-20-15-10-11-16(14-9-5-4-8-13(14)15)21(18,19)17-12-6-2-3-7-12/h4-5,8-12,17H,2-3,6-7H2,1H3 |
| InChIKey | HITRBVPKOJIYMJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |