C18H20F3NO3S — CID 55691636
4-methoxy-N-[2-(trifluoromethyl)cyclohexyl]naphthalene-1-sulfonamide (PubChem CID 55691636) has the molecular formula C18H20F3NO3S and a molecular weight of 387.42 g/mol. Its IUPAC name is 4-methoxy-N-[2-(trifluoromethyl)cyclohexyl]naphthalene-1-sulfonamide.
| Compound Name | 4-methoxy-N-[2-(trifluoromethyl)cyclohexyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 55691636 |
| Molecular Formula | C18H20F3NO3S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 4-methoxy-N-[2-(trifluoromethyl)cyclohexyl]naphthalene-1-sulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC2CCCCC2C(F)(F)F)c2ccccc12 |
| InChI | InChI=1S/C18H20F3NO3S/c1-25-16-10-11-17(13-7-3-2-6-12(13)16)26(23,24)22-15-9-5-4-8-14(15)18(19,20)21/h2-3,6-7,10-11,14-15,22H,4-5,8-9H2,1H3 |
| InChIKey | WLRSAXHEWXTWBW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |