C14H15F4NO4S — CID 100631857
3-fluoro-4-[[(1S,2R)-2-(trifluoromethyl)cyclohexyl]sulfamoyl]benzoic acid (PubChem CID 100631857) has the molecular formula C14H15F4NO4S and a molecular weight of 369.34 g/mol. Its IUPAC name is 3-fluoro-4-[[(1S,2R)-2-(trifluoromethyl)cyclohexyl]sulfamoyl]benzoic acid.
| Compound Name | 3-fluoro-4-[[(1S,2R)-2-(trifluoromethyl)cyclohexyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 100631857 |
| Molecular Formula | C14H15F4NO4S |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 3-fluoro-4-[[(1S,2R)-2-(trifluoromethyl)cyclohexyl]sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)N[C@H]2CCCC[C@H]2C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C14H15F4NO4S/c15-10-7-8(13(20)21)5-6-12(10)24(22,23)19-11-4-2-1-3-9(11)14(16,17)18/h5-7,9,11,19H,1-4H2,(H,20,21)/t9-,11+/m1/s1 |
| InChIKey | XFUCACKIMWFIBN-KOLCDFICSA-N |
| XLogP | 2.92 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |