C14H18FNO4S — CID 79178105
4-[(2,3-dimethylcyclopentyl)sulfamoyl]-3-fluorobenzoic acid (PubChem CID 79178105) has the molecular formula C14H18FNO4S and a molecular weight of 315.37 g/mol. Its IUPAC name is 4-[(2,3-dimethylcyclopentyl)sulfamoyl]-3-fluorobenzoic acid.
| Compound Name | 4-[(2,3-dimethylcyclopentyl)sulfamoyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 79178105 |
| Molecular Formula | C14H18FNO4S |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 4-[(2,3-dimethylcyclopentyl)sulfamoyl]-3-fluorobenzoic acid |
| SMILES | CC1CCC(NS(=O)(=O)c2ccc(C(=O)O)cc2F)C1C |
| InChI | InChI=1S/C14H18FNO4S/c1-8-3-5-12(9(8)2)16-21(19,20)13-6-4-10(14(17)18)7-11(13)15/h4,6-9,12,16H,3,5H2,1-2H3,(H,17,18) |
| InChIKey | NBLIFJLEGKKEIQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |