C13H16FNO5S — CID 79177880
3-fluoro-4-[(2-methoxycyclopentyl)sulfamoyl]benzoic acid (PubChem CID 79177880) has the molecular formula C13H16FNO5S and a molecular weight of 317.34 g/mol. Its IUPAC name is 3-fluoro-4-[(2-methoxycyclopentyl)sulfamoyl]benzoic acid.
| Compound Name | 3-fluoro-4-[(2-methoxycyclopentyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 79177880 |
| Molecular Formula | C13H16FNO5S |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 3-fluoro-4-[(2-methoxycyclopentyl)sulfamoyl]benzoic acid |
| SMILES | COC1CCCC1NS(=O)(=O)c1ccc(C(=O)O)cc1F |
| InChI | InChI=1S/C13H16FNO5S/c1-20-11-4-2-3-10(11)15-21(18,19)12-6-5-8(13(16)17)7-9(12)14/h5-7,10-11,15H,2-4H2,1H3,(H,16,17) |
| InChIKey | MKCFMAAHOWJTOJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |