C14H16FNO4S — CID 166302985
3-fluoro-4-[[(1R)-4-methylcyclohex-3-en-1-yl]sulfamoyl]benzoic acid (PubChem CID 166302985) has the molecular formula C14H16FNO4S and a molecular weight of 313.35 g/mol. Its IUPAC name is 3-fluoro-4-[[(1R)-4-methylcyclohex-3-en-1-yl]sulfamoyl]benzoic acid.
| Compound Name | 3-fluoro-4-[[(1R)-4-methylcyclohex-3-en-1-yl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 166302985 |
| Molecular Formula | C14H16FNO4S |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 3-fluoro-4-[[(1R)-4-methylcyclohex-3-en-1-yl]sulfamoyl]benzoic acid |
| SMILES | CC1=CC[C@H](NS(=O)(=O)c2ccc(C(=O)O)cc2F)CC1 |
| InChI | InChI=1S/C14H16FNO4S/c1-9-2-5-11(6-3-9)16-21(19,20)13-7-4-10(14(17)18)8-12(13)15/h2,4,7-8,11,16H,3,5-6H2,1H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | WBFXDXJDQBKAHN-NSHDSACASA-N |
| XLogP | 2.30 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|