C17H20ClNO2S — CID 39116315
4-chloro-N-[(1R,2S)-2-methylcyclohexyl]naphthalene-1-sulfonamide (PubChem CID 39116315) has the molecular formula C17H20ClNO2S and a molecular weight of 337.87 g/mol. Its IUPAC name is 4-chloro-N-[(1R,2S)-2-methylcyclohexyl]naphthalene-1-sulfonamide.
| Compound Name | 4-chloro-N-[(1R,2S)-2-methylcyclohexyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 39116315 |
| Molecular Formula | C17H20ClNO2S |
| Molecular Weight | 337.87 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 4-chloro-N-[(1R,2S)-2-methylcyclohexyl]naphthalene-1-sulfonamide |
| SMILES | C[C@H]1CCCC[C@H]1NS(=O)(=O)c1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C17H20ClNO2S/c1-12-6-2-5-9-16(12)19-22(20,21)17-11-10-15(18)13-7-3-4-8-14(13)17/h3-4,7-8,10-12,16,19H,2,5-6,9H2,1H3/t12-,16+/m0/s1 |
| InChIKey | XWMFYGOLOJKMSD-BLLLJJGKSA-N |
| XLogP | 4.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.87 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |