C14H19Cl2NO2S — CID 39116281
4,5-dichloro-2-methyl-N-[(1S,2S)-2-methylcyclohexyl]benzenesulfonamide (PubChem CID 39116281) has the molecular formula C14H19Cl2NO2S and a molecular weight of 336.28 g/mol. Its IUPAC name is 4,5-dichloro-2-methyl-N-[(1S,2S)-2-methylcyclohexyl]benzenesulfonamide.
| Compound Name | 4,5-dichloro-2-methyl-N-[(1S,2S)-2-methylcyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 39116281 |
| Molecular Formula | C14H19Cl2NO2S |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 4,5-dichloro-2-methyl-N-[(1S,2S)-2-methylcyclohexyl]benzenesulfonamide |
| SMILES | Cc1cc(Cl)c(Cl)cc1S(=O)(=O)N[C@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C14H19Cl2NO2S/c1-9-5-3-4-6-13(9)17-20(18,19)14-8-12(16)11(15)7-10(14)2/h7-9,13,17H,3-6H2,1-2H3/t9-,13-/m0/s1 |
| InChIKey | OWPVLYVOZVKXNW-ZANVPECISA-N |
| XLogP | 4.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |