C15H21Br2NO2S — CID 81435568
2,5-dibromo-4-methyl-N-(2-methylcycloheptyl)benzenesulfonamide (PubChem CID 81435568) has the molecular formula C15H21Br2NO2S and a molecular weight of 439.21 g/mol. Its IUPAC name is 2,5-dibromo-4-methyl-N-(2-methylcycloheptyl)benzenesulfonamide.
| Compound Name | 2,5-dibromo-4-methyl-N-(2-methylcycloheptyl)benzenesulfonamide |
|---|---|
| PubChem CID | 81435568 |
| Molecular Formula | C15H21Br2NO2S |
| Molecular Weight | 439.21 g/mol |
| Exact Mass | 436.97 |
| IUPAC Name | 2,5-dibromo-4-methyl-N-(2-methylcycloheptyl)benzenesulfonamide |
| SMILES | Cc1cc(Br)c(S(=O)(=O)NC2CCCCCC2C)cc1Br |
| InChI | InChI=1S/C15H21Br2NO2S/c1-10-6-4-3-5-7-14(10)18-21(19,20)15-9-12(16)11(2)8-13(15)17/h8-10,14,18H,3-7H2,1-2H3 |
| InChIKey | DHPCIIVLZHAFQV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.21 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |