C12H14Br3NO2S — CID 81326896
2,5-dibromo-N-(2-bromocyclopentyl)-4-methylbenzenesulfonamide (PubChem CID 81326896) has the molecular formula C12H14Br3NO2S and a molecular weight of 476.03 g/mol. Its IUPAC name is 2,5-dibromo-N-(2-bromocyclopentyl)-4-methylbenzenesulfonamide.
| Compound Name | 2,5-dibromo-N-(2-bromocyclopentyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 81326896 |
| Molecular Formula | C12H14Br3NO2S |
| Molecular Weight | 476.03 g/mol |
| Exact Mass | 472.83 |
| IUPAC Name | 2,5-dibromo-N-(2-bromocyclopentyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1cc(Br)c(S(=O)(=O)NC2CCCC2Br)cc1Br |
| InChI | InChI=1S/C12H14Br3NO2S/c1-7-5-10(15)12(6-9(7)14)19(17,18)16-11-4-2-3-8(11)13/h5-6,8,11,16H,2-4H2,1H3 |
| InChIKey | ITZUKAKCOGSRJM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.03 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|