C15H23BrN2O3S — CID 119986113
N-[2-(aminomethyl)cyclohexyl]-5-bromo-2-methoxy-4-methylbenzenesulfonamide (PubChem CID 119986113) has the molecular formula C15H23BrN2O3S and a molecular weight of 391.33 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-5-bromo-2-methoxy-4-methylbenzenesulfonamide.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-5-bromo-2-methoxy-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 119986113 |
| Molecular Formula | C15H23BrN2O3S |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-5-bromo-2-methoxy-4-methylbenzenesulfonamide |
| SMILES | COc1cc(C)c(Br)cc1S(=O)(=O)NC1CCCCC1CN |
| InChI | InChI=1S/C15H23BrN2O3S/c1-10-7-14(21-2)15(8-12(10)16)22(19,20)18-13-6-4-3-5-11(13)9-17/h7-8,11,13,18H,3-6,9,17H2,1-2H3 |
| InChIKey | YSTBQUSOZICVJO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |