C14H18Br3NO2S — CID 114297544
2,5-dibromo-N-[(2-bromocyclohexyl)methyl]-4-methylbenzenesulfonamide (PubChem CID 114297544) has the molecular formula C14H18Br3NO2S and a molecular weight of 504.08 g/mol. Its IUPAC name is 2,5-dibromo-N-[(2-bromocyclohexyl)methyl]-4-methylbenzenesulfonamide.
| Compound Name | 2,5-dibromo-N-[(2-bromocyclohexyl)methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 114297544 |
| Molecular Formula | C14H18Br3NO2S |
| Molecular Weight | 504.08 g/mol |
| Exact Mass | 500.86 |
| IUPAC Name | 2,5-dibromo-N-[(2-bromocyclohexyl)methyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1cc(Br)c(S(=O)(=O)NCC2CCCCC2Br)cc1Br |
| InChI | InChI=1S/C14H18Br3NO2S/c1-9-6-13(17)14(7-12(9)16)21(19,20)18-8-10-4-2-3-5-11(10)15/h6-7,10-11,18H,2-5,8H2,1H3 |
| InChIKey | GKVGYYWTHIGAJX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.08 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|