C14H19Br2NO3S — CID 103990940
2,5-dibromo-4-methyl-N-[2-(oxan-2-yl)ethyl]benzenesulfonamide (PubChem CID 103990940) has the molecular formula C14H19Br2NO3S and a molecular weight of 441.19 g/mol. Its IUPAC name is 2,5-dibromo-4-methyl-N-[2-(oxan-2-yl)ethyl]benzenesulfonamide.
| Compound Name | 2,5-dibromo-4-methyl-N-[2-(oxan-2-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 103990940 |
| Molecular Formula | C14H19Br2NO3S |
| Molecular Weight | 441.19 g/mol |
| Exact Mass | 438.95 |
| IUPAC Name | 2,5-dibromo-4-methyl-N-[2-(oxan-2-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1cc(Br)c(S(=O)(=O)NCCC2CCCCO2)cc1Br |
| InChI | InChI=1S/C14H19Br2NO3S/c1-10-8-13(16)14(9-12(10)15)21(18,19)17-6-5-11-4-2-3-7-20-11/h8-9,11,17H,2-7H2,1H3 |
| InChIKey | GGWBSSGVHVIFCU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.19 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |