C14H20BrNO3S — CID 103990999
4-bromo-3-methyl-N-[2-(oxan-2-yl)ethyl]benzenesulfonamide (PubChem CID 103990999) has the molecular formula C14H20BrNO3S and a molecular weight of 362.29 g/mol. Its IUPAC name is 4-bromo-3-methyl-N-[2-(oxan-2-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-bromo-3-methyl-N-[2-(oxan-2-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 103990999 |
| Molecular Formula | C14H20BrNO3S |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 4-bromo-3-methyl-N-[2-(oxan-2-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCC2CCCCO2)ccc1Br |
| InChI | InChI=1S/C14H20BrNO3S/c1-11-10-13(5-6-14(11)15)20(17,18)16-8-7-12-4-2-3-9-19-12/h5-6,10,12,16H,2-4,7-9H2,1H3 |
| InChIKey | QSJZBABEDPQAPG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |