C12H16FNO5S2 — CID 114958224
4-[2-(oxolan-2-yl)ethylsulfamoyl]benzenesulfonyl fluoride (PubChem CID 114958224) has the molecular formula C12H16FNO5S2 and a molecular weight of 337.39 g/mol. Its IUPAC name is 4-[2-(oxolan-2-yl)ethylsulfamoyl]benzenesulfonyl fluoride.
| Compound Name | 4-[2-(oxolan-2-yl)ethylsulfamoyl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 114958224 |
| Molecular Formula | C12H16FNO5S2 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 4-[2-(oxolan-2-yl)ethylsulfamoyl]benzenesulfonyl fluoride |
| SMILES | O=S(=O)(F)c1ccc(S(=O)(=O)NCCC2CCCO2)cc1 |
| InChI | InChI=1S/C12H16FNO5S2/c13-20(15,16)11-3-5-12(6-4-11)21(17,18)14-8-7-10-2-1-9-19-10/h3-6,10,14H,1-2,7-9H2 |
| InChIKey | ZEHMGIFMEREQCR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |