C15H20F3NO5S — CID 24511255
N-[3-(oxolan-2-ylmethoxy)propyl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 24511255) has the molecular formula C15H20F3NO5S and a molecular weight of 383.39 g/mol. Its IUPAC name is N-[3-(oxolan-2-ylmethoxy)propyl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[3-(oxolan-2-ylmethoxy)propyl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 24511255 |
| Molecular Formula | C15H20F3NO5S |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | N-[3-(oxolan-2-ylmethoxy)propyl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(NCCCOCC1CCCO1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H20F3NO5S/c16-15(17,18)24-12-4-6-14(7-5-12)25(20,21)19-8-2-9-22-11-13-3-1-10-23-13/h4-7,13,19H,1-3,8-11H2 |
| InChIKey | PWWXUDHSMHAANL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|