C14H19Cl2NO4S — CID 24511243
2,6-dichloro-N-[3-(oxolan-2-ylmethoxy)propyl]benzenesulfonamide (PubChem CID 24511243) has the molecular formula C14H19Cl2NO4S and a molecular weight of 368.28 g/mol. Its IUPAC name is 2,6-dichloro-N-[3-(oxolan-2-ylmethoxy)propyl]benzenesulfonamide.
| Compound Name | 2,6-dichloro-N-[3-(oxolan-2-ylmethoxy)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24511243 |
| Molecular Formula | C14H19Cl2NO4S |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 2,6-dichloro-N-[3-(oxolan-2-ylmethoxy)propyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCCOCC1CCCO1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H19Cl2NO4S/c15-12-5-1-6-13(16)14(12)22(18,19)17-7-3-8-20-10-11-4-2-9-21-11/h1,5-6,11,17H,2-4,7-10H2 |
| InChIKey | UEVRFFNDTHIEHX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|