C14H21ClN2O4S — CID 95733836
1-(6-chloro-3-pyridinyl)-N-[3-[[(2R)-oxolan-2-yl]methoxy]propyl]methanesulfonamide (PubChem CID 95733836) has the molecular formula C14H21ClN2O4S and a molecular weight of 348.85 g/mol. Its IUPAC name is 1-(6-chloro-3-pyridinyl)-N-[3-[[(2R)-oxolan-2-yl]methoxy]propyl]methanesulfonamide.
| Compound Name | 1-(6-chloro-3-pyridinyl)-N-[3-[[(2R)-oxolan-2-yl]methoxy]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 95733836 |
| Molecular Formula | C14H21ClN2O4S |
| Molecular Weight | 348.85 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 1-(6-chloro-3-pyridinyl)-N-[3-[[(2R)-oxolan-2-yl]methoxy]propyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccc(Cl)nc1)NCCCOC[C@H]1CCCO1 |
| InChI | InChI=1S/C14H21ClN2O4S/c15-14-5-4-12(9-16-14)11-22(18,19)17-6-2-7-20-10-13-3-1-8-21-13/h4-5,9,13,17H,1-3,6-8,10-11H2/t13-/m1/s1 |
| InChIKey | FXFZWJFDLIQNSS-CYBMUJFWSA-N |
| XLogP | 1.74 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.85 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|