C15H22ClNO3S — CID 131913148
1-(3-chlorophenyl)-N-[4-(oxolan-2-yl)butyl]methanesulfonamide (PubChem CID 131913148) has the molecular formula C15H22ClNO3S and a molecular weight of 331.86 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[4-(oxolan-2-yl)butyl]methanesulfonamide.
| Compound Name | 1-(3-chlorophenyl)-N-[4-(oxolan-2-yl)butyl]methanesulfonamide |
|---|---|
| PubChem CID | 131913148 |
| Molecular Formula | C15H22ClNO3S |
| Molecular Weight | 331.86 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[4-(oxolan-2-yl)butyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1cccc(Cl)c1)NCCCCC1CCCO1 |
| InChI | InChI=1S/C15H22ClNO3S/c16-14-6-3-5-13(11-14)12-21(18,19)17-9-2-1-7-15-8-4-10-20-15/h3,5-6,11,15,17H,1-2,4,7-10,12H2 |
| InChIKey | KQOYMZQYHOTWSD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.86 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|