C15H21ClO2 — CID 66060580
2-[(3-chlorophenyl)methyl]-4-(oxolan-2-yl)butan-1-ol (PubChem CID 66060580) has the molecular formula C15H21ClO2 and a molecular weight of 268.78 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-4-(oxolan-2-yl)butan-1-ol.
| Compound Name | 2-[(3-chlorophenyl)methyl]-4-(oxolan-2-yl)butan-1-ol |
|---|---|
| PubChem CID | 66060580 |
| Molecular Formula | C15H21ClO2 |
| Molecular Weight | 268.78 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-4-(oxolan-2-yl)butan-1-ol |
| SMILES | OCC(CCC1CCCO1)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H21ClO2/c16-14-4-1-3-12(10-14)9-13(11-17)6-7-15-5-2-8-18-15/h1,3-4,10,13,15,17H,2,5-9,11H2 |
| InChIKey | CZVDNOWMPLMVHD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.78 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |