C16H22F3NO4S — CID 87032494
4-cyclopentyloxy-N-[3-(2,2,2-trifluoroethoxy)propyl]benzenesulfonamide (PubChem CID 87032494) has the molecular formula C16H22F3NO4S and a molecular weight of 381.42 g/mol. Its IUPAC name is 4-cyclopentyloxy-N-[3-(2,2,2-trifluoroethoxy)propyl]benzenesulfonamide.
| Compound Name | 4-cyclopentyloxy-N-[3-(2,2,2-trifluoroethoxy)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 87032494 |
| Molecular Formula | C16H22F3NO4S |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 4-cyclopentyloxy-N-[3-(2,2,2-trifluoroethoxy)propyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCCOCC(F)(F)F)c1ccc(OC2CCCC2)cc1 |
| InChI | InChI=1S/C16H22F3NO4S/c17-16(18,19)12-23-11-3-10-20-25(21,22)15-8-6-14(7-9-15)24-13-4-1-2-5-13/h6-9,13,20H,1-5,10-12H2 |
| InChIKey | HABXIZZXHUOREM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|