C11H13ClF3NO3S — CID 86931251
2-chloro-N-[3-(2,2,2-trifluoroethoxy)propyl]benzenesulfonamide (PubChem CID 86931251) has the molecular formula C11H13ClF3NO3S and a molecular weight of 331.74 g/mol. Its IUPAC name is 2-chloro-N-[3-(2,2,2-trifluoroethoxy)propyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[3-(2,2,2-trifluoroethoxy)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 86931251 |
| Molecular Formula | C11H13ClF3NO3S |
| Molecular Weight | 331.74 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 2-chloro-N-[3-(2,2,2-trifluoroethoxy)propyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCCOCC(F)(F)F)c1ccccc1Cl |
| InChI | InChI=1S/C11H13ClF3NO3S/c12-9-4-1-2-5-10(9)20(17,18)16-6-3-7-19-8-11(13,14)15/h1-2,4-5,16H,3,6-8H2 |
| InChIKey | VSZCFIKERYFQAI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.74 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|