C14H23NO5S2 — CID 55559217
N-(3-butoxypropyl)-2-methylsulfonylbenzenesulfonamide (PubChem CID 55559217) has the molecular formula C14H23NO5S2 and a molecular weight of 349.47 g/mol. Its IUPAC name is N-(3-butoxypropyl)-2-methylsulfonylbenzenesulfonamide.
| Compound Name | N-(3-butoxypropyl)-2-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 55559217 |
| Molecular Formula | C14H23NO5S2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-(3-butoxypropyl)-2-methylsulfonylbenzenesulfonamide |
| SMILES | CCCCOCCCNS(=O)(=O)c1ccccc1S(C)(=O)=O |
| InChI | InChI=1S/C14H23NO5S2/c1-3-4-11-20-12-7-10-15-22(18,19)14-9-6-5-8-13(14)21(2,16)17/h5-6,8-9,15H,3-4,7,10-12H2,1-2H3 |
| InChIKey | YPJMOTXCVYGSSI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|