C14H25N3O3S — CID 106308340
2-[3-(2-aminoethoxy)propylamino]-N-propylbenzenesulfonamide (PubChem CID 106308340) has the molecular formula C14H25N3O3S and a molecular weight of 315.44 g/mol. Its IUPAC name is 2-[3-(2-aminoethoxy)propylamino]-N-propylbenzenesulfonamide.
| Compound Name | 2-[3-(2-aminoethoxy)propylamino]-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 106308340 |
| Molecular Formula | C14H25N3O3S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 2-[3-(2-aminoethoxy)propylamino]-N-propylbenzenesulfonamide |
| SMILES | CCCNS(=O)(=O)c1ccccc1NCCCOCCN |
| InChI | InChI=1S/C14H25N3O3S/c1-2-9-17-21(18,19)14-7-4-3-6-13(14)16-10-5-11-20-12-8-15/h3-4,6-7,16-17H,2,5,8-12,15H2,1H3 |
| InChIKey | FOEPDVSAWRUWRR-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|