C20H25F3N2O5S — CID 164862396
N-[3-[furan-2-ylmethyl(oxolan-2-ylmethyl)amino]propyl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 164862396) has the molecular formula C20H25F3N2O5S and a molecular weight of 462.49 g/mol. Its IUPAC name is N-[3-[furan-2-ylmethyl(oxolan-2-ylmethyl)amino]propyl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[3-[furan-2-ylmethyl(oxolan-2-ylmethyl)amino]propyl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 164862396 |
| Molecular Formula | C20H25F3N2O5S |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | N-[3-[furan-2-ylmethyl(oxolan-2-ylmethyl)amino]propyl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(NCCCN(Cc1ccco1)CC1CCCO1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H25F3N2O5S/c21-20(22,23)30-16-6-8-19(9-7-16)31(26,27)24-10-3-11-25(14-17-4-1-12-28-17)15-18-5-2-13-29-18/h1,4,6-9,12,18,24H,2-3,5,10-11,13-15H2 |
| InChIKey | OGWLHCKCRBQLPI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|