C17H22N2O4 — CID 47537569
N-(furan-2-ylmethyl)-2-[furan-2-ylmethyl(oxolan-2-ylmethyl)amino]acetamide (PubChem CID 47537569) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[furan-2-ylmethyl(oxolan-2-ylmethyl)amino]acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[furan-2-ylmethyl(oxolan-2-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 47537569 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[furan-2-ylmethyl(oxolan-2-ylmethyl)amino]acetamide |
| SMILES | O=C(CN(Cc1ccco1)CC1CCCO1)NCc1ccco1 |
| InChI | InChI=1S/C17H22N2O4/c20-17(18-10-14-4-1-7-21-14)13-19(11-15-5-2-8-22-15)12-16-6-3-9-23-16/h1-2,4-5,7-8,16H,3,6,9-13H2,(H,18,20) |
| InChIKey | VGTLGVZWPKUKGV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 67.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |