C20H24N2O4 — CID 60585132
N-(3-acetylphenyl)-2-[furan-2-ylmethyl(oxolan-2-ylmethyl)amino]acetamide (PubChem CID 60585132) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-[furan-2-ylmethyl(oxolan-2-ylmethyl)amino]acetamide.
| Compound Name | N-(3-acetylphenyl)-2-[furan-2-ylmethyl(oxolan-2-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 60585132 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | N-(3-acetylphenyl)-2-[furan-2-ylmethyl(oxolan-2-ylmethyl)amino]acetamide |
| SMILES | CC(=O)c1cccc(NC(=O)CN(Cc2ccco2)CC2CCCO2)c1 |
| InChI | InChI=1S/C20H24N2O4/c1-15(23)16-5-2-6-17(11-16)21-20(24)14-22(12-18-7-3-9-25-18)13-19-8-4-10-26-19/h2-3,5-7,9,11,19H,4,8,10,12-14H2,1H3,(H,21,24) |
| InChIKey | VBOJSXPUUKGCOK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |