C21H27N3O3S — CID 8926142
N-ethyl-3-[[2-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]acetyl]amino]benzamide (PubChem CID 8926142) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is N-ethyl-3-[[2-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]acetyl]amino]benzamide.
| Compound Name | N-ethyl-3-[[2-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 8926142 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N-ethyl-3-[[2-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]acetyl]amino]benzamide |
| SMILES | CCNC(=O)c1cccc(NC(=O)CN(Cc2cccs2)C[C@@H]2CCCO2)c1 |
| InChI | InChI=1S/C21H27N3O3S/c1-2-22-21(26)16-6-3-7-17(12-16)23-20(25)15-24(13-18-8-4-10-27-18)14-19-9-5-11-28-19/h3,5-7,9,11-12,18H,2,4,8,10,13-15H2,1H3,(H,22,26)(H,23,25)/t18-/m0/s1 |
| InChIKey | RBPXWVZRARROPK-SFHVURJKSA-N |
| XLogP | 3.12 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |