C19H21N3O2S — CID 9055119
N-(3-cyanophenyl)-2-[[(2R)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]acetamide (PubChem CID 9055119) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-[[(2R)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]acetamide.
| Compound Name | N-(3-cyanophenyl)-2-[[(2R)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 9055119 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-(3-cyanophenyl)-2-[[(2R)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]acetamide |
| SMILES | N#Cc1cccc(NC(=O)CN(Cc2cccs2)C[C@H]2CCCO2)c1 |
| InChI | InChI=1S/C19H21N3O2S/c20-11-15-4-1-5-16(10-15)21-19(23)14-22(12-17-6-2-8-24-17)13-18-7-3-9-25-18/h1,3-5,7,9-10,17H,2,6,8,12-14H2,(H,21,23)/t17-/m1/s1 |
| InChIKey | HYVZRNVUMRWPDM-QGZVFWFLSA-N |
| XLogP | 3.24 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |