C22H29N3O3S — CID 40790537
N-(4-morpholin-4-ylphenyl)-2-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]acetamide (PubChem CID 40790537) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-2-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]acetamide.
| Compound Name | N-(4-morpholin-4-ylphenyl)-2-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 40790537 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-2-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]acetamide |
| SMILES | O=C(CN(Cc1cccs1)C[C@@H]1CCCO1)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H29N3O3S/c26-22(23-18-5-7-19(8-6-18)25-9-12-27-13-10-25)17-24(15-20-3-1-11-28-20)16-21-4-2-14-29-21/h2,4-8,14,20H,1,3,9-13,15-17H2,(H,23,26)/t20-/m0/s1 |
| InChIKey | DTXRJJOMJYTOCW-FQEVSTJZSA-N |
| XLogP | 3.20 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|