C24H33N3O2S — CID 9296357
N-[4-(azepan-1-yl)phenyl]-2-[[(2R)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]acetamide (PubChem CID 9296357) has the molecular formula C24H33N3O2S and a molecular weight of 427.61 g/mol. Its IUPAC name is N-[4-(azepan-1-yl)phenyl]-2-[[(2R)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]acetamide.
| Compound Name | N-[4-(azepan-1-yl)phenyl]-2-[[(2R)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 9296357 |
| Molecular Formula | C24H33N3O2S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | N-[4-(azepan-1-yl)phenyl]-2-[[(2R)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]acetamide |
| SMILES | O=C(CN(Cc1cccs1)C[C@H]1CCCO1)Nc1ccc(N2CCCCCC2)cc1 |
| InChI | InChI=1S/C24H33N3O2S/c28-24(19-26(17-22-7-5-15-29-22)18-23-8-6-16-30-23)25-20-9-11-21(12-10-20)27-13-3-1-2-4-14-27/h6,8-12,16,22H,1-5,7,13-15,17-19H2,(H,25,28)/t22-/m1/s1 |
| InChIKey | HDSOTLYQLNCOAO-JOCHJYFZSA-N |
| XLogP | 4.75 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|