C12H16Br2N2O3S — CID 115323952
2,5-dibromo-4-methyl-N-(morpholin-2-ylmethyl)benzenesulfonamide (PubChem CID 115323952) has the molecular formula C12H16Br2N2O3S and a molecular weight of 428.15 g/mol. Its IUPAC name is 2,5-dibromo-4-methyl-N-(morpholin-2-ylmethyl)benzenesulfonamide.
| Compound Name | 2,5-dibromo-4-methyl-N-(morpholin-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115323952 |
| Molecular Formula | C12H16Br2N2O3S |
| Molecular Weight | 428.15 g/mol |
| Exact Mass | 425.92 |
| IUPAC Name | 2,5-dibromo-4-methyl-N-(morpholin-2-ylmethyl)benzenesulfonamide |
| SMILES | Cc1cc(Br)c(S(=O)(=O)NCC2CNCCO2)cc1Br |
| InChI | InChI=1S/C12H16Br2N2O3S/c1-8-4-11(14)12(5-10(8)13)20(17,18)16-7-9-6-15-2-3-19-9/h4-5,9,15-16H,2-3,6-7H2,1H3 |
| InChIKey | BCNUSRNHFJNSFB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.15 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |