C9H12BrClN2O3S2 — CID 115323934
5-bromo-4-chloro-N-(morpholin-2-ylmethyl)thiophene-2-sulfonamide (PubChem CID 115323934) has the molecular formula C9H12BrClN2O3S2 and a molecular weight of 375.70 g/mol. Its IUPAC name is 5-bromo-4-chloro-N-(morpholin-2-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-chloro-N-(morpholin-2-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 115323934 |
| Molecular Formula | C9H12BrClN2O3S2 |
| Molecular Weight | 375.70 g/mol |
| Exact Mass | 373.92 |
| IUPAC Name | 5-bromo-4-chloro-N-(morpholin-2-ylmethyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCC1CNCCO1)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C9H12BrClN2O3S2/c10-9-7(11)3-8(17-9)18(14,15)13-5-6-4-12-1-2-16-6/h3,6,12-13H,1-2,4-5H2 |
| InChIKey | QZIAOACBDOKNSK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.70 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |