C8H10BrClN2O2S2 — CID 80577813
5-bromo-4-chloro-N-[(3R)-pyrrolidin-3-yl]thiophene-2-sulfonamide (PubChem CID 80577813) has the molecular formula C8H10BrClN2O2S2 and a molecular weight of 345.67 g/mol. Its IUPAC name is 5-bromo-4-chloro-N-[(3R)-pyrrolidin-3-yl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-chloro-N-[(3R)-pyrrolidin-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80577813 |
| Molecular Formula | C8H10BrClN2O2S2 |
| Molecular Weight | 345.67 g/mol |
| Exact Mass | 343.91 |
| IUPAC Name | 5-bromo-4-chloro-N-[(3R)-pyrrolidin-3-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(N[C@@H]1CCNC1)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C8H10BrClN2O2S2/c9-8-6(10)3-7(15-8)16(13,14)12-5-1-2-11-4-5/h3,5,11-12H,1-2,4H2/t5-/m1/s1 |
| InChIKey | VDPWZAKFSYCVML-RXMQYKEDSA-N |
| XLogP | 1.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.67 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |