C10H11Cl3N2O2S — CID 79686004
2,4,6-trichloro-N-[(3S)-pyrrolidin-3-yl]benzenesulfonamide (PubChem CID 79686004) has the molecular formula C10H11Cl3N2O2S and a molecular weight of 329.64 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[(3S)-pyrrolidin-3-yl]benzenesulfonamide.
| Compound Name | 2,4,6-trichloro-N-[(3S)-pyrrolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 79686004 |
| Molecular Formula | C10H11Cl3N2O2S |
| Molecular Weight | 329.64 g/mol |
| Exact Mass | 327.96 |
| IUPAC Name | 2,4,6-trichloro-N-[(3S)-pyrrolidin-3-yl]benzenesulfonamide |
| SMILES | O=S(=O)(N[C@H]1CCNC1)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C10H11Cl3N2O2S/c11-6-3-8(12)10(9(13)4-6)18(16,17)15-7-1-2-14-5-7/h3-4,7,14-15H,1-2,5H2/t7-/m0/s1 |
| InChIKey | PWGTULDEIWIQBB-ZETCQYMHSA-N |
| XLogP | 2.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.64 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |