C12H15ClN2O4S — CID 119967067
methyl 3-chloro-4-(pyrrolidin-3-ylsulfamoyl)benzoate (PubChem CID 119967067) has the molecular formula C12H15ClN2O4S and a molecular weight of 318.78 g/mol. Its IUPAC name is methyl 3-chloro-4-(pyrrolidin-3-ylsulfamoyl)benzoate.
| Compound Name | methyl 3-chloro-4-(pyrrolidin-3-ylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 119967067 |
| Molecular Formula | C12H15ClN2O4S |
| Molecular Weight | 318.78 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | methyl 3-chloro-4-(pyrrolidin-3-ylsulfamoyl)benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NC2CCNC2)c(Cl)c1 |
| InChI | InChI=1S/C12H15ClN2O4S/c1-19-12(16)8-2-3-11(10(13)6-8)20(17,18)15-9-4-5-14-7-9/h2-3,6,9,14-15H,4-5,7H2,1H3 |
| InChIKey | DPJWXNKKYAGQNY-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.78 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |