C14H20N2O5S — CID 120706280
methyl 3-methoxy-4-(piperidin-4-ylsulfamoyl)benzoate (PubChem CID 120706280) has the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. Its IUPAC name is methyl 3-methoxy-4-(piperidin-4-ylsulfamoyl)benzoate.
| Compound Name | methyl 3-methoxy-4-(piperidin-4-ylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 120706280 |
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | methyl 3-methoxy-4-(piperidin-4-ylsulfamoyl)benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NC2CCNCC2)c(OC)c1 |
| InChI | InChI=1S/C14H20N2O5S/c1-20-12-9-10(14(17)21-2)3-4-13(12)22(18,19)16-11-5-7-15-8-6-11/h3-4,9,11,15-16H,5-8H2,1-2H3 |
| InChIKey | BJWYRKUGFYGOSA-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |