C12H19ClN2O5S2 — CID 119960673
methyl 4-methoxy-5-(piperidin-4-ylsulfamoyl)thiophene-2-carboxylate;hydrochloride (PubChem CID 119960673) has the molecular formula C12H19ClN2O5S2 and a molecular weight of 370.88 g/mol. Its IUPAC name is methyl 4-methoxy-5-(piperidin-4-ylsulfamoyl)thiophene-2-carboxylate;hydrochloride.
| Compound Name | methyl 4-methoxy-5-(piperidin-4-ylsulfamoyl)thiophene-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 119960673 |
| Molecular Formula | C12H19ClN2O5S2 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | methyl 4-methoxy-5-(piperidin-4-ylsulfamoyl)thiophene-2-carboxylate;hydrochloride |
| SMILES | COC(=O)c1cc(OC)c(S(=O)(=O)NC2CCNCC2)s1.Cl |
| InChI | InChI=1S/C12H18N2O5S2.ClH/c1-18-9-7-10(11(15)19-2)20-12(9)21(16,17)14-8-3-5-13-6-4-8;/h7-8,13-14H,3-6H2,1-2H3;1H |
| InChIKey | USFFWGDWYFEPMR-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |