C12H18N2O4S2 — CID 69034720
methyl 4-methyl-5-(piperidin-4-ylsulfamoyl)thiophene-2-carboxylate (PubChem CID 69034720) has the molecular formula C12H18N2O4S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is methyl 4-methyl-5-(piperidin-4-ylsulfamoyl)thiophene-2-carboxylate.
| Compound Name | methyl 4-methyl-5-(piperidin-4-ylsulfamoyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 69034720 |
| Molecular Formula | C12H18N2O4S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | methyl 4-methyl-5-(piperidin-4-ylsulfamoyl)thiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(C)c(S(=O)(=O)NC2CCNCC2)s1 |
| InChI | InChI=1S/C12H18N2O4S2/c1-8-7-10(11(15)18-2)19-12(8)20(16,17)14-9-3-5-13-6-4-9/h7,9,13-14H,3-6H2,1-2H3 |
| InChIKey | SLIMZRJYBCPHHM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |