C12H16BrNO5S2 — CID 43428154
methyl 5-bromo-4-[(4-hydroxycyclohexyl)sulfamoyl]thiophene-2-carboxylate (PubChem CID 43428154) has the molecular formula C12H16BrNO5S2 and a molecular weight of 398.30 g/mol. Its IUPAC name is methyl 5-bromo-4-[(4-hydroxycyclohexyl)sulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-bromo-4-[(4-hydroxycyclohexyl)sulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 43428154 |
| Molecular Formula | C12H16BrNO5S2 |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 396.97 |
| IUPAC Name | methyl 5-bromo-4-[(4-hydroxycyclohexyl)sulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)NC2CCC(O)CC2)c(Br)s1 |
| InChI | InChI=1S/C12H16BrNO5S2/c1-19-12(16)9-6-10(11(13)20-9)21(17,18)14-7-2-4-8(15)5-3-7/h6-8,14-15H,2-5H2,1H3 |
| InChIKey | UZUKFGFKZKJJSY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |