C8H9BrN2O5S2 — CID 64591938
methyl 4-[(2-amino-2-oxoethyl)sulfamoyl]-5-bromothiophene-2-carboxylate (PubChem CID 64591938) has the molecular formula C8H9BrN2O5S2 and a molecular weight of 357.21 g/mol. Its IUPAC name is methyl 4-[(2-amino-2-oxoethyl)sulfamoyl]-5-bromothiophene-2-carboxylate.
| Compound Name | methyl 4-[(2-amino-2-oxoethyl)sulfamoyl]-5-bromothiophene-2-carboxylate |
|---|---|
| PubChem CID | 64591938 |
| Molecular Formula | C8H9BrN2O5S2 |
| Molecular Weight | 357.21 g/mol |
| Exact Mass | 355.91 |
| IUPAC Name | methyl 4-[(2-amino-2-oxoethyl)sulfamoyl]-5-bromothiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)NCC(N)=O)c(Br)s1 |
| InChI | InChI=1S/C8H9BrN2O5S2/c1-16-8(13)4-2-5(7(9)17-4)18(14,15)11-3-6(10)12/h2,11H,3H2,1H3,(H2,10,12) |
| InChIKey | VJYZMGQZGOYFHP-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.21 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |