C7H9BrN2O4S2 — CID 61403030
4-(2-aminoethylsulfamoyl)-5-bromothiophene-2-carboxylic acid (PubChem CID 61403030) has the molecular formula C7H9BrN2O4S2 and a molecular weight of 329.20 g/mol. Its IUPAC name is 4-(2-aminoethylsulfamoyl)-5-bromothiophene-2-carboxylic acid.
| Compound Name | 4-(2-aminoethylsulfamoyl)-5-bromothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 61403030 |
| Molecular Formula | C7H9BrN2O4S2 |
| Molecular Weight | 329.20 g/mol |
| Exact Mass | 327.92 |
| IUPAC Name | 4-(2-aminoethylsulfamoyl)-5-bromothiophene-2-carboxylic acid |
| SMILES | NCCNS(=O)(=O)c1cc(C(=O)O)sc1Br |
| InChI | InChI=1S/C7H9BrN2O4S2/c8-6-5(3-4(15-6)7(11)12)16(13,14)10-2-1-9/h3,10H,1-2,9H2,(H,11,12) |
| InChIKey | DRAPYTBZXLZIFK-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.20 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |