C11H12BrN3O4S2 — CID 103004774
5-bromo-4-[2-(2-methylpyrazol-3-yl)ethylsulfamoyl]thiophene-2-carboxylic acid (PubChem CID 103004774) has the molecular formula C11H12BrN3O4S2 and a molecular weight of 394.27 g/mol. Its IUPAC name is 5-bromo-4-[2-(2-methylpyrazol-3-yl)ethylsulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-bromo-4-[2-(2-methylpyrazol-3-yl)ethylsulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 103004774 |
| Molecular Formula | C11H12BrN3O4S2 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 392.95 |
| IUPAC Name | 5-bromo-4-[2-(2-methylpyrazol-3-yl)ethylsulfamoyl]thiophene-2-carboxylic acid |
| SMILES | Cn1nccc1CCNS(=O)(=O)c1cc(C(=O)O)sc1Br |
| InChI | InChI=1S/C11H12BrN3O4S2/c1-15-7(2-4-13-15)3-5-14-21(18,19)9-6-8(11(16)17)20-10(9)12/h2,4,6,14H,3,5H2,1H3,(H,16,17) |
| InChIKey | FCMZOMIXXGVAIS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |