C11H11BrN2O4S2 — CID 106415067
5-bromo-4-[(1-methylpyrrol-2-yl)methylsulfamoyl]thiophene-2-carboxylic acid (PubChem CID 106415067) has the molecular formula C11H11BrN2O4S2 and a molecular weight of 379.26 g/mol. Its IUPAC name is 5-bromo-4-[(1-methylpyrrol-2-yl)methylsulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-bromo-4-[(1-methylpyrrol-2-yl)methylsulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 106415067 |
| Molecular Formula | C11H11BrN2O4S2 |
| Molecular Weight | 379.26 g/mol |
| Exact Mass | 377.93 |
| IUPAC Name | 5-bromo-4-[(1-methylpyrrol-2-yl)methylsulfamoyl]thiophene-2-carboxylic acid |
| SMILES | Cn1cccc1CNS(=O)(=O)c1cc(C(=O)O)sc1Br |
| InChI | InChI=1S/C11H11BrN2O4S2/c1-14-4-2-3-7(14)6-13-20(17,18)9-5-8(11(15)16)19-10(9)12/h2-5,13H,6H2,1H3,(H,15,16) |
| InChIKey | ULKZMPDUNJEBBL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |